C25H32O5 — CID 141024320
ethyl 2-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]oct-4-enoate (PubChem CID 141024320) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is ethyl 2-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]oct-4-enoate.
| Compound Name | ethyl 2-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]oct-4-enoate |
|---|---|
| PubChem CID | 141024320 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | ethyl 2-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]oct-4-enoate |
| SMILES | CCCC=CCC(C(=O)OCC)c1cccc(OCc2ccc(CO)c(CO)c2)c1 |
| InChI | InChI=1S/C25H32O5/c1-3-5-6-7-11-24(25(28)29-4-2)20-9-8-10-23(15-20)30-18-19-12-13-21(16-26)22(14-19)17-27/h6-10,12-15,24,26-27H,3-5,11,16-18H2,1-2H3 |
| InChIKey | IIXKYYXVDGJRNF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|