About bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate
bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate (PubChem CID 141028107) has the molecular formula C9H9AlO9
and a molecular weight of 288.14 g/mol. Its IUPAC name is bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate.
Molecular Properties
| Compound Name | bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate |
| PubChem CID | 141028107 |
| Molecular Formula | C9H9AlO9 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate |
| SMILES | O=CCC(=O)O[Al](OC(=O)CC=O)OC(=O)CC=O |
| InChI | InChI=1S/3C3H4O3.Al/c3*4-2-1-3(5)6;/h3*2H,1H2,(H,5,6);/q;;;+3/p-3 |
| InChIKey | XISLAKGMLRLKSX-UHFFFAOYSA-K |
| XLogP | -1.63 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate?
The IUPAC name of bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate (CID 141028107) is bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate.
What is the SMILES notation for bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate?
The canonical SMILES for bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate is O=CCC(=O)O[Al](OC(=O)CC=O)OC(=O)CC=O.
What is the InChIKey of bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate?
The InChIKey is XISLAKGMLRLKSX-UHFFFAOYSA-K. The full InChI is InChI=1S/3C3H4O3.Al/c3*4-2-1-3(5)6;/h3*2H,1H2,(H,5,6);/q;;;+3/p-3.
What are the key properties of bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate?
bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate has a molecular weight of 288.14 g/mol, XLogP of -1.63, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-oxopropanoyloxy)alumanyl 3-oxopropanoate is sourced from PubChem (CID 141028107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).