C5H9Na2O7P — CID 141028194
disodium;3,4,5-trihydroxy-5-phosphonatopentan-2-one (PubChem CID 141028194) has the molecular formula C5H9Na2O7P and a molecular weight of 258.07 g/mol. Its IUPAC name is disodium;3,4,5-trihydroxy-5-phosphonatopentan-2-one.
| Compound Name | disodium;3,4,5-trihydroxy-5-phosphonatopentan-2-one |
|---|---|
| PubChem CID | 141028194 |
| Molecular Formula | C5H9Na2O7P |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | disodium;3,4,5-trihydroxy-5-phosphonatopentan-2-one |
| SMILES | CC(=O)C(O)C(O)C(O)P(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H11O7P.2Na/c1-2(6)3(7)4(8)5(9)13(10,11)12;;/h3-5,7-9H,1H3,(H2,10,11,12);;/q;2*+1/p-2 |
| InChIKey | SLPMGHULPIYPQQ-UHFFFAOYSA-L |
| XLogP | -9.46 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | -9.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|