C6H11Na2O6P — CID 162060084
disodium;3,4-dihydroxy-6-phosphonatohexan-2-one (PubChem CID 162060084) has the molecular formula C6H11Na2O6P and a molecular weight of 256.10 g/mol. Its IUPAC name is disodium;3,4-dihydroxy-6-phosphonatohexan-2-one.
| Compound Name | disodium;3,4-dihydroxy-6-phosphonatohexan-2-one |
|---|---|
| PubChem CID | 162060084 |
| Molecular Formula | C6H11Na2O6P |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | disodium;3,4-dihydroxy-6-phosphonatohexan-2-one |
| SMILES | CC(=O)C(O)C(O)CCP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H13O6P.2Na/c1-4(7)6(9)5(8)2-3-13(10,11)12;;/h5-6,8-9H,2-3H2,1H3,(H2,10,11,12);;/q;2*+1/p-2 |
| InChIKey | YZSFYEDKUKAEGH-UHFFFAOYSA-L |
| XLogP | -8.39 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | -8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|