C34H57NO4S — CID 141028767
2-[2,3-dimethyl-4-[(Z)-octadec-9-enyl]phenyl]-5-(prop-2-enoylamino)pentane-2-sulfonic acid (PubChem CID 141028767) has the molecular formula C34H57NO4S and a molecular weight of 575.90 g/mol. Its IUPAC name is 2-[2,3-dimethyl-4-[(Z)-octadec-9-enyl]phenyl]-5-(prop-2-enoylamino)pentane-2-sulfonic acid.
| Compound Name | 2-[2,3-dimethyl-4-[(Z)-octadec-9-enyl]phenyl]-5-(prop-2-enoylamino)pentane-2-sulfonic acid |
|---|---|
| PubChem CID | 141028767 |
| Molecular Formula | C34H57NO4S |
| Molecular Weight | 575.90 g/mol |
| Exact Mass | 575.40 |
| IUPAC Name | 2-[2,3-dimethyl-4-[(Z)-octadec-9-enyl]phenyl]-5-(prop-2-enoylamino)pentane-2-sulfonic acid |
| SMILES | C=CC(=O)NCCCC(C)(c1ccc(CCCCCCCC/C=C\CCCCCCCC)c(C)c1C)S(=O)(=O)O |
| InChI | InChI=1S/C34H57NO4S/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-31-25-26-32(30(4)29(31)3)34(5,40(37,38)39)27-23-28-35-33(36)7-2/h7,14-15,25-26H,2,6,8-13,16-24,27-28H2,1,3-5H3,(H,35,36)(H,37,38,39)/b15-14- |
| InChIKey | GHPJVEVSVFWTQJ-PFONDFGASA-N |
| XLogP | 9.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.90 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|