C12H14 — CID 141031457
4-ethyldeca-2,5,7-triyne (PubChem CID 141031457) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 4-ethyldeca-2,5,7-triyne.
| Compound Name | 4-ethyldeca-2,5,7-triyne |
|---|---|
| PubChem CID | 141031457 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 4-ethyldeca-2,5,7-triyne |
| SMILES | CC#CC(C#CC#CCC)CC |
| InChI | InChI=1S/C12H14/c1-4-7-8-9-11-12(6-3)10-5-2/h12H,4,6H2,1-3H3 |
| InChIKey | KMHMDLXVZMELNT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|