C24H22N4O8 — CID 141034538
2-N-ethyl-1-N',2-N'-bis(4-methoxy-1-benzofuran-2-carbonyl)ethanedihydrazide (PubChem CID 141034538) has the molecular formula C24H22N4O8 and a molecular weight of 494.46 g/mol. Its IUPAC name is 2-N-ethyl-1-N',2-N'-bis(4-methoxy-1-benzofuran-2-carbonyl)ethanedihydrazide.
| Compound Name | 2-N-ethyl-1-N',2-N'-bis(4-methoxy-1-benzofuran-2-carbonyl)ethanedihydrazide |
|---|---|
| PubChem CID | 141034538 |
| Molecular Formula | C24H22N4O8 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-N-ethyl-1-N',2-N'-bis(4-methoxy-1-benzofuran-2-carbonyl)ethanedihydrazide |
| SMILES | CCN(NC(=O)c1cc2c(OC)cccc2o1)C(=O)C(=O)NNC(=O)c1cc2c(OC)cccc2o1 |
| InChI | InChI=1S/C24H22N4O8/c1-4-28(27-22(30)20-12-14-16(34-3)8-6-10-18(14)36-20)24(32)23(31)26-25-21(29)19-11-13-15(33-2)7-5-9-17(13)35-19/h5-12H,4H2,1-3H3,(H,25,29)(H,26,31)(H,27,30) |
| InChIKey | VVESLXKBEFWQNA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 152.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|