About (2S)-2-amino-3-hydroxypropanimidate;triethylazanium
(2S)-2-amino-3-hydroxypropanimidate;triethylazanium (PubChem CID 141039034) has the molecular formula C9H23N3O2
and a molecular weight of 205.30 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanimidate;triethylazanium.
Molecular Properties
| Compound Name | (2S)-2-amino-3-hydroxypropanimidate;triethylazanium |
| PubChem CID | 141039034 |
| Molecular Formula | C9H23N3O2 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanimidate;triethylazanium |
| SMILES | CC[NH+](CC)CC.[H]/N=C(\[O-])[C@@H](N)CO |
| InChI | InChI=1S/C6H15N.C3H8N2O2/c1-4-7(5-2)6-3;4-2(1-6)3(5)7/h4-6H2,1-3H3;2,6H,1,4H2,(H2,5,7)/t;2-/m.0/s1 |
| InChIKey | HNWSRKUZESWZLV-WNQIDUERSA-N |
| XLogP | -2.43 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-hydroxypropanimidate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-hydroxypropanimidate;triethylazanium?
The IUPAC name of (2S)-2-amino-3-hydroxypropanimidate;triethylazanium (CID 141039034) is (2S)-2-amino-3-hydroxypropanimidate;triethylazanium.
What is the SMILES notation for (2S)-2-amino-3-hydroxypropanimidate;triethylazanium?
The canonical SMILES for (2S)-2-amino-3-hydroxypropanimidate;triethylazanium is CC[NH+](CC)CC.[H]/N=C(\[O-])[C@@H](N)CO.
What is the InChIKey of (2S)-2-amino-3-hydroxypropanimidate;triethylazanium?
The InChIKey is HNWSRKUZESWZLV-WNQIDUERSA-N. The full InChI is InChI=1S/C6H15N.C3H8N2O2/c1-4-7(5-2)6-3;4-2(1-6)3(5)7/h4-6H2,1-3H3;2,6H,1,4H2,(H2,5,7)/t;2-/m.0/s1.
What are the key properties of (2S)-2-amino-3-hydroxypropanimidate;triethylazanium?
(2S)-2-amino-3-hydroxypropanimidate;triethylazanium has a molecular weight of 205.30 g/mol, XLogP of -2.43, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-hydroxypropanimidate;triethylazanium is sourced from PubChem (CID 141039034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).