About 2-ethylbutanimidate;hydrochloride
2-ethylbutanimidate;hydrochloride (PubChem CID 19082418) has the molecular formula C6H13ClNO-
and a molecular weight of 150.63 g/mol. Its IUPAC name is 2-ethylbutanimidate;hydrochloride.
Molecular Properties
| Compound Name | 2-ethylbutanimidate;hydrochloride |
| PubChem CID | 19082418 |
| Molecular Formula | C6H13ClNO- |
| Molecular Weight | 150.63 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2-ethylbutanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\[O-])C(CC)CC |
| InChI | InChI=1S/C6H13NO.ClH/c1-3-5(4-2)6(7)8;/h5H,3-4H2,1-2H3,(H2,7,8);1H/p-1 |
| InChIKey | NZNRHJPZXCZRHS-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.63 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbutanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutanimidate;hydrochloride?
The IUPAC name of 2-ethylbutanimidate;hydrochloride (CID 19082418) is 2-ethylbutanimidate;hydrochloride.
What is the SMILES notation for 2-ethylbutanimidate;hydrochloride?
The canonical SMILES for 2-ethylbutanimidate;hydrochloride is Cl.[H]/N=C(\[O-])C(CC)CC.
What is the InChIKey of 2-ethylbutanimidate;hydrochloride?
The InChIKey is NZNRHJPZXCZRHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H13NO.ClH/c1-3-5(4-2)6(7)8;/h5H,3-4H2,1-2H3,(H2,7,8);1H/p-1.
What are the key properties of 2-ethylbutanimidate;hydrochloride?
2-ethylbutanimidate;hydrochloride has a molecular weight of 150.63 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutanimidate;hydrochloride is sourced from PubChem (CID 19082418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).