About hydron;propanimidate;hydrochloride
hydron;propanimidate;hydrochloride (PubChem CID 173251815) has the molecular formula C3H8ClNO
and a molecular weight of 109.56 g/mol. Its IUPAC name is hydron;propanimidate;hydrochloride.
Molecular Properties
| Compound Name | hydron;propanimidate;hydrochloride |
| PubChem CID | 173251815 |
| Molecular Formula | C3H8ClNO |
| Molecular Weight | 109.56 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | hydron;propanimidate;hydrochloride |
| SMILES | Cl.[H+].[H]/N=C(\[O-])CC |
| InChI | InChI=1S/C3H7NO.ClH/c1-2-3(4)5;/h2H2,1H3,(H2,4,5);1H |
| InChIKey | VHWJSJBTUWUEAL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.56 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;propanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;propanimidate;hydrochloride?
The IUPAC name of hydron;propanimidate;hydrochloride (CID 173251815) is hydron;propanimidate;hydrochloride.
What is the SMILES notation for hydron;propanimidate;hydrochloride?
The canonical SMILES for hydron;propanimidate;hydrochloride is Cl.[H+].[H]/N=C(\[O-])CC.
What is the InChIKey of hydron;propanimidate;hydrochloride?
The InChIKey is VHWJSJBTUWUEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.ClH/c1-2-3(4)5;/h2H2,1H3,(H2,4,5);1H.
What are the key properties of hydron;propanimidate;hydrochloride?
hydron;propanimidate;hydrochloride has a molecular weight of 109.56 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;propanimidate;hydrochloride is sourced from PubChem (CID 173251815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).