About barium(2+);bis(5-imino-5-oxido-2-oxopentanoate)
barium(2+);bis(5-imino-5-oxido-2-oxopentanoate) (PubChem CID 170987959) has the molecular formula C10H10BaN2O8-2
and a molecular weight of 423.52 g/mol. Its IUPAC name is barium(2+);bis(5-imino-5-oxido-2-oxopentanoate).
Molecular Properties
| Compound Name | barium(2+);bis(5-imino-5-oxido-2-oxopentanoate) |
| PubChem CID | 170987959 |
| Molecular Formula | C10H10BaN2O8-2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | barium(2+);bis(5-imino-5-oxido-2-oxopentanoate) |
| SMILES | [Ba+2].[H]/N=C(/[O-])CCC(=O)C(=O)[O-].[H]/N=C(\[O-])CCC(=O)C(=O)[O-] |
| InChI | InChI=1S/2C5H7NO4.Ba/c2*6-4(8)2-1-3(7)5(9)10;/h2*1-2H2,(H2,6,8)(H,9,10);/q;;+2/p-4 |
| InChIKey | AZGCTNYYMIMSIL-UHFFFAOYSA-J |
| XLogP | -5.53 |
| TPSA | 208.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | -5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(5-imino-5-oxido-2-oxopentanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(5-imino-5-oxido-2-oxopentanoate)?
The IUPAC name of barium(2+);bis(5-imino-5-oxido-2-oxopentanoate) (CID 170987959) is barium(2+);bis(5-imino-5-oxido-2-oxopentanoate).
What is the SMILES notation for barium(2+);bis(5-imino-5-oxido-2-oxopentanoate)?
The canonical SMILES for barium(2+);bis(5-imino-5-oxido-2-oxopentanoate) is [Ba+2].[H]/N=C(/[O-])CCC(=O)C(=O)[O-].[H]/N=C(\[O-])CCC(=O)C(=O)[O-].
What is the InChIKey of barium(2+);bis(5-imino-5-oxido-2-oxopentanoate)?
The InChIKey is AZGCTNYYMIMSIL-UHFFFAOYSA-J. The full InChI is InChI=1S/2C5H7NO4.Ba/c2*6-4(8)2-1-3(7)5(9)10;/h2*1-2H2,(H2,6,8)(H,9,10);/q;;+2/p-4.
What are the key properties of barium(2+);bis(5-imino-5-oxido-2-oxopentanoate)?
barium(2+);bis(5-imino-5-oxido-2-oxopentanoate) has a molecular weight of 423.52 g/mol, XLogP of -5.53, 8 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(5-imino-5-oxido-2-oxopentanoate) is sourced from PubChem (CID 170987959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).