C8H8O8Sr — CID 160568269
strontium;5-hydroxy-2,5-dioxopentanoate;2-oxopropanoate (PubChem CID 160568269) has the molecular formula C8H8O8Sr and a molecular weight of 319.76 g/mol. Its IUPAC name is strontium;5-hydroxy-2,5-dioxopentanoate;2-oxopropanoate.
| Compound Name | strontium;5-hydroxy-2,5-dioxopentanoate;2-oxopropanoate |
|---|---|
| PubChem CID | 160568269 |
| Molecular Formula | C8H8O8Sr |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | strontium;5-hydroxy-2,5-dioxopentanoate;2-oxopropanoate |
| SMILES | CC(=O)C(=O)[O-].O=C(O)CCC(=O)C(=O)[O-].[Sr+2] |
| InChI | InChI=1S/C5H6O5.C3H4O3.Sr/c6-3(5(9)10)1-2-4(7)8;1-2(4)3(5)6;/h1-2H2,(H,7,8)(H,9,10);1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | RAFDYKDBSPCBIE-UHFFFAOYSA-L |
| XLogP | -3.89 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|