About 2-methyloctanimidate;tetrabutylazanium
2-methyloctanimidate;tetrabutylazanium (PubChem CID 159243241) has the molecular formula C25H54N2O
and a molecular weight of 398.72 g/mol. Its IUPAC name is 2-methyloctanimidate;tetrabutylazanium.
Molecular Properties
| Compound Name | 2-methyloctanimidate;tetrabutylazanium |
| PubChem CID | 159243241 |
| Molecular Formula | C25H54N2O |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.42 |
| IUPAC Name | 2-methyloctanimidate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[H]/N=C(\[O-])C(C)CCCCCC |
| InChI | InChI=1S/C16H36N.C9H19NO/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-4-5-6-7-8(2)9(10)11/h5-16H2,1-4H3;8H,3-7H2,1-2H3,(H2,10,11)/q+1;/p-1 |
| InChIKey | KUIXQBPDYLVHIF-UHFFFAOYSA-M |
| XLogP | 6.93 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloctanimidate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloctanimidate;tetrabutylazanium?
The IUPAC name of 2-methyloctanimidate;tetrabutylazanium (CID 159243241) is 2-methyloctanimidate;tetrabutylazanium.
What is the SMILES notation for 2-methyloctanimidate;tetrabutylazanium?
The canonical SMILES for 2-methyloctanimidate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.[H]/N=C(\[O-])C(C)CCCCCC.
What is the InChIKey of 2-methyloctanimidate;tetrabutylazanium?
The InChIKey is KUIXQBPDYLVHIF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C9H19NO/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-3-4-5-6-7-8(2)9(10)11/h5-16H2,1-4H3;8H,3-7H2,1-2H3,(H2,10,11)/q+1;/p-1.
What are the key properties of 2-methyloctanimidate;tetrabutylazanium?
2-methyloctanimidate;tetrabutylazanium has a molecular weight of 398.72 g/mol, XLogP of 6.93, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloctanimidate;tetrabutylazanium is sourced from PubChem (CID 159243241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).