C12H26N2O2 — CID 159668750
2-ethyl-N,N-dipropoxybutanimidamide (PubChem CID 159668750) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-ethyl-N,N-dipropoxybutanimidamide.
| Compound Name | 2-ethyl-N,N-dipropoxybutanimidamide |
|---|---|
| PubChem CID | 159668750 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-ethyl-N,N-dipropoxybutanimidamide |
| SMILES | [H]/N=C(\C(CC)CC)N(OCCC)OCCC |
| InChI | InChI=1S/C12H26N2O2/c1-5-9-15-14(16-10-6-2)12(13)11(7-3)8-4/h11,13H,5-10H2,1-4H3/b13-12+ |
| InChIKey | PUTFWDXWHCJNEM-OUKQBFOZSA-N |
| XLogP | 3.39 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|