C13H19NO3 — CID 141041340
tert-butyl (3R)-3-(1,3-oxazol-2-yl)hex-5-enoate (PubChem CID 141041340) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl (3R)-3-(1,3-oxazol-2-yl)hex-5-enoate.
| Compound Name | tert-butyl (3R)-3-(1,3-oxazol-2-yl)hex-5-enoate |
|---|---|
| PubChem CID | 141041340 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | tert-butyl (3R)-3-(1,3-oxazol-2-yl)hex-5-enoate |
| SMILES | C=CC[C@H](CC(=O)OC(C)(C)C)c1ncco1 |
| InChI | InChI=1S/C13H19NO3/c1-5-6-10(12-14-7-8-16-12)9-11(15)17-13(2,3)4/h5,7-8,10H,1,6,9H2,2-4H3/t10-/m1/s1 |
| InChIKey | GVIJKRJTNPOMCJ-SNVBAGLBSA-N |
| XLogP | 3.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|