C17H24N2O3 — CID 142535625
tert-butyl N-[(3Z)-2-(1,3-oxazol-2-yl)-3-prop-1-en-2-ylhexa-3,5-dienyl]carbamate (PubChem CID 142535625) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-[(3Z)-2-(1,3-oxazol-2-yl)-3-prop-1-en-2-ylhexa-3,5-dienyl]carbamate.
| Compound Name | tert-butyl N-[(3Z)-2-(1,3-oxazol-2-yl)-3-prop-1-en-2-ylhexa-3,5-dienyl]carbamate |
|---|---|
| PubChem CID | 142535625 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl N-[(3Z)-2-(1,3-oxazol-2-yl)-3-prop-1-en-2-ylhexa-3,5-dienyl]carbamate |
| SMILES | C=C/C=C(\C(=C)C)C(CNC(=O)OC(C)(C)C)c1ncco1 |
| InChI | InChI=1S/C17H24N2O3/c1-7-8-13(12(2)3)14(15-18-9-10-21-15)11-19-16(20)22-17(4,5)6/h7-10,14H,1-2,11H2,3-6H3,(H,19,20)/b13-8+ |
| InChIKey | SQZALIRQLJJRKP-MDWZMJQESA-N |
| XLogP | 3.97 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|