C20H16N2O4 — CID 141043486
[2-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-3-yl]methanol (PubChem CID 141043486) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is [2-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-3-yl]methanol.
| Compound Name | [2-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-3-yl]methanol |
|---|---|
| PubChem CID | 141043486 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [2-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-3-yl]methanol |
| SMILES | OCc1ccoc1-c1nn(Cc2ccccc2)c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C20H16N2O4/c23-11-14-6-7-24-20(14)19-15-8-17-18(26-12-25-17)9-16(15)22(21-19)10-13-4-2-1-3-5-13/h1-9,23H,10-12H2 |
| InChIKey | CKVHFJSEDSAFDQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |