C11H15N3OS — CID 141044014
O-ethyl 4-(cyclopropylamino)-2-methylpyrimidine-5-carbothioate (PubChem CID 141044014) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is O-ethyl 4-(cyclopropylamino)-2-methylpyrimidine-5-carbothioate.
| Compound Name | O-ethyl 4-(cyclopropylamino)-2-methylpyrimidine-5-carbothioate |
|---|---|
| PubChem CID | 141044014 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | O-ethyl 4-(cyclopropylamino)-2-methylpyrimidine-5-carbothioate |
| SMILES | CCOC(=S)c1cnc(C)nc1NC1CC1 |
| InChI | InChI=1S/C11H15N3OS/c1-3-15-11(16)9-6-12-7(2)13-10(9)14-8-4-5-8/h6,8H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | QUFIIVOXQYKCLY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|