C32H28O4 — CID 141045503
2-[9-(1-carboxy-2-phenylethyl)-10H-anthracen-9-yl]-3-phenylpropanoic acid (PubChem CID 141045503) has the molecular formula C32H28O4 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-[9-(1-carboxy-2-phenylethyl)-10H-anthracen-9-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[9-(1-carboxy-2-phenylethyl)-10H-anthracen-9-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 141045503 |
| Molecular Formula | C32H28O4 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-[9-(1-carboxy-2-phenylethyl)-10H-anthracen-9-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)C1(C(Cc2ccccc2)C(=O)O)c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C32H28O4/c33-30(34)28(19-22-11-3-1-4-12-22)32(29(31(35)36)20-23-13-5-2-6-14-23)26-17-9-7-15-24(26)21-25-16-8-10-18-27(25)32/h1-18,28-29H,19-21H2,(H,33,34)(H,35,36) |
| InChIKey | KROBBOMZOGBQLE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |