C24H28O4 — CID 151931048
2-[9-(1-carboxybutyl)-10H-anthracen-9-yl]pentanoic acid (PubChem CID 151931048) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-[9-(1-carboxybutyl)-10H-anthracen-9-yl]pentanoic acid.
| Compound Name | 2-[9-(1-carboxybutyl)-10H-anthracen-9-yl]pentanoic acid |
|---|---|
| PubChem CID | 151931048 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[9-(1-carboxybutyl)-10H-anthracen-9-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)C1(C(CCC)C(=O)O)c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C24H28O4/c1-3-9-20(22(25)26)24(21(10-4-2)23(27)28)18-13-7-5-11-16(18)15-17-12-6-8-14-19(17)24/h5-8,11-14,20-21H,3-4,9-10,15H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | SYUJOHYRDZPUAK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |