C8H8N2O — CID 141046823
3-methyl-5H-imidazo[1,5-a]pyridin-1-one (PubChem CID 141046823) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-methyl-5H-imidazo[1,5-a]pyridin-1-one.
| Compound Name | 3-methyl-5H-imidazo[1,5-a]pyridin-1-one |
|---|---|
| PubChem CID | 141046823 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 3-methyl-5H-imidazo[1,5-a]pyridin-1-one |
| SMILES | CC1=NC(=O)C2=CC=CCN21 |
| InChI | InChI=1S/C8H8N2O/c1-6-9-8(11)7-4-2-3-5-10(6)7/h2-4H,5H2,1H3 |
| InChIKey | KVAZUGUUYBIZBG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |