C23H37N3O2 — CID 141050434
4-[6-(but-3-enylamino)hexoxy]-N-(4-methylphenyl)piperidine-1-carboxamide (PubChem CID 141050434) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 4-[6-(but-3-enylamino)hexoxy]-N-(4-methylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-[6-(but-3-enylamino)hexoxy]-N-(4-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 141050434 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 4-[6-(but-3-enylamino)hexoxy]-N-(4-methylphenyl)piperidine-1-carboxamide |
| SMILES | C=CCCNCCCCCCOC1CCN(C(=O)Nc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H37N3O2/c1-3-4-15-24-16-7-5-6-8-19-28-22-13-17-26(18-14-22)23(27)25-21-11-9-20(2)10-12-21/h3,9-12,22,24H,1,4-8,13-19H2,2H3,(H,25,27) |
| InChIKey | LDWNNHHVTFTWOB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|