C22H34BrN3O2 — CID 141050431
N-(4-bromophenyl)-4-[6-(but-3-enylamino)hexoxy]piperidine-1-carboxamide (PubChem CID 141050431) has the molecular formula C22H34BrN3O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[6-(but-3-enylamino)hexoxy]piperidine-1-carboxamide.
| Compound Name | N-(4-bromophenyl)-4-[6-(but-3-enylamino)hexoxy]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 141050431 |
| Molecular Formula | C22H34BrN3O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-(4-bromophenyl)-4-[6-(but-3-enylamino)hexoxy]piperidine-1-carboxamide |
| SMILES | C=CCCNCCCCCCOC1CCN(C(=O)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C22H34BrN3O2/c1-2-3-14-24-15-6-4-5-7-18-28-21-12-16-26(17-13-21)22(27)25-20-10-8-19(23)9-11-20/h2,8-11,21,24H,1,3-7,12-18H2,(H,25,27) |
| InChIKey | PWCHPWIFBRQTQJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|