C9H7F2N3O — CID 141052888
2-[(3,5-difluorophenyl)methyl]-4H-1,2,4-triazol-3-one (PubChem CID 141052888) has the molecular formula C9H7F2N3O and a molecular weight of 211.17 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-4H-1,2,4-triazol-3-one.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 141052888 |
| Molecular Formula | C9H7F2N3O |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-4H-1,2,4-triazol-3-one |
| SMILES | O=c1[nH]cnn1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H7F2N3O/c10-7-1-6(2-8(11)3-7)4-14-9(15)12-5-13-14/h1-3,5H,4H2,(H,12,13,15) |
| InChIKey | QSHBSYMGSMRGHG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |