C13H8Cl2OS — CID 141060514
2,4-dichloro-2H-benzo[g]thiochromene 1-oxide (PubChem CID 141060514) has the molecular formula C13H8Cl2OS and a molecular weight of 283.18 g/mol. Its IUPAC name is 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide.
| Compound Name | 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide |
|---|---|
| PubChem CID | 141060514 |
| Molecular Formula | C13H8Cl2OS |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide |
| SMILES | O=S1c2cc3ccccc3cc2C(Cl)=CC1Cl |
| InChI | InChI=1S/C13H8Cl2OS/c14-11-7-13(15)17(16)12-6-9-4-2-1-3-8(9)5-10(11)12/h1-7,13H |
| InChIKey | NJZJOKAQCFAENT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|