2,4-dichloro-2H-benzo[g]thiochromene 1-oxide

C13H8Cl2OS — CID 141060514

IUPAC2,4-dichloro-2H-benzo[g]thiochromene 1-oxide
SMILESO=S1c2cc3ccccc3cc2C(Cl)=CC1Cl
InChIInChI=1S/C13H8Cl2OS/c14-11-7-13(15)17(16)12-6-9-4-2-1-3-8(9)5-10(11)12/h1-7,13H
InChIKeyNJZJOKAQCFAENT-UHFFFAOYSA-N
MW283.18 g/mol
LogP4.11
Rot. Bonds

About 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide

2,4-dichloro-2H-benzo[g]thiochromene 1-oxide (PubChem CID 141060514) has the molecular formula C13H8Cl2OS and a molecular weight of 283.18 g/mol. Its IUPAC name is 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide.

Molecular Properties

Compound Name2,4-dichloro-2H-benzo[g]thiochromene 1-oxide
PubChem CID141060514
Molecular FormulaC13H8Cl2OS
Molecular Weight283.18 g/mol
Exact Mass281.97
IUPAC Name2,4-dichloro-2H-benzo[g]thiochromene 1-oxide
SMILESO=S1c2cc3ccccc3cc2C(Cl)=CC1Cl
InChIInChI=1S/C13H8Cl2OS/c14-11-7-13(15)17(16)12-6-9-4-2-1-3-8(9)5-10(11)12/h1-7,13H
InChIKeyNJZJOKAQCFAENT-UHFFFAOYSA-N
XLogP4.11
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.18
LogP ≤ 54.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide?
The IUPAC name of 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide (CID 141060514) is 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide.
What is the SMILES notation for 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide?
The canonical SMILES for 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide is O=S1c2cc3ccccc3cc2C(Cl)=CC1Cl.
What is the InChIKey of 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide?
The InChIKey is NJZJOKAQCFAENT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2OS/c14-11-7-13(15)17(16)12-6-9-4-2-1-3-8(9)5-10(11)12/h1-7,13H.
What are the key properties of 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide?
2,4-dichloro-2H-benzo[g]thiochromene 1-oxide has a molecular weight of 283.18 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-2H-benzo[g]thiochromene 1-oxide is sourced from PubChem (CID 141060514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).