C18H10O4 — CID 54358442
3-hydroxytetracene-1,2,4-trione (PubChem CID 54358442) has the molecular formula C18H10O4 and a molecular weight of 290.27 g/mol. Its IUPAC name is 3-hydroxytetracene-1,2,4-trione.
| Compound Name | 3-hydroxytetracene-1,2,4-trione |
|---|---|
| PubChem CID | 54358442 |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-hydroxytetracene-1,2,4-trione |
| SMILES | O=C1C(=O)C(O)C(=O)c2cc3cc4ccccc4cc3cc21 |
| InChI | InChI=1S/C18H10O4/c19-15-13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14(13)16(20)18(22)17(15)21/h1-8,17,21H |
| InChIKey | UKTRIDLPWWUSQY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|