About 2-phenyl-2H-benzo[g]thiochromene 1-oxide
2-phenyl-2H-benzo[g]thiochromene 1-oxide (PubChem CID 178076131) has the molecular formula C19H14OS
and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-phenyl-2H-benzo[g]thiochromene 1-oxide.
Molecular Properties
| Compound Name | 2-phenyl-2H-benzo[g]thiochromene 1-oxide |
| PubChem CID | 178076131 |
| Molecular Formula | C19H14OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-phenyl-2H-benzo[g]thiochromene 1-oxide |
| SMILES | O=S1c2cc3ccccc3cc2C=CC1c1ccccc1 |
| InChI | InChI=1S/C19H14OS/c20-21-18(14-6-2-1-3-7-14)11-10-17-12-15-8-4-5-9-16(15)13-19(17)21/h1-13,18H |
| InChIKey | DMQMXOVHGGIKQQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-2H-benzo[g]thiochromene 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2H-benzo[g]thiochromene 1-oxide?
The IUPAC name of 2-phenyl-2H-benzo[g]thiochromene 1-oxide (CID 178076131) is 2-phenyl-2H-benzo[g]thiochromene 1-oxide.
What is the SMILES notation for 2-phenyl-2H-benzo[g]thiochromene 1-oxide?
The canonical SMILES for 2-phenyl-2H-benzo[g]thiochromene 1-oxide is O=S1c2cc3ccccc3cc2C=CC1c1ccccc1.
What is the InChIKey of 2-phenyl-2H-benzo[g]thiochromene 1-oxide?
The InChIKey is DMQMXOVHGGIKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14OS/c20-21-18(14-6-2-1-3-7-14)11-10-17-12-15-8-4-5-9-16(15)13-19(17)21/h1-13,18H.
What are the key properties of 2-phenyl-2H-benzo[g]thiochromene 1-oxide?
2-phenyl-2H-benzo[g]thiochromene 1-oxide has a molecular weight of 290.39 g/mol, XLogP of 4.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2H-benzo[g]thiochromene 1-oxide is sourced from PubChem (CID 178076131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).