C23H30FNO — CID 141064411
2-(dimethylamino)-4-[(4-fluorophenyl)methyl]-1-(2-phenylethyl)cyclohexan-1-ol (PubChem CID 141064411) has the molecular formula C23H30FNO and a molecular weight of 355.50 g/mol. Its IUPAC name is 2-(dimethylamino)-4-[(4-fluorophenyl)methyl]-1-(2-phenylethyl)cyclohexan-1-ol.
| Compound Name | 2-(dimethylamino)-4-[(4-fluorophenyl)methyl]-1-(2-phenylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 141064411 |
| Molecular Formula | C23H30FNO |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2-(dimethylamino)-4-[(4-fluorophenyl)methyl]-1-(2-phenylethyl)cyclohexan-1-ol |
| SMILES | CN(C)C1CC(Cc2ccc(F)cc2)CCC1(O)CCc1ccccc1 |
| InChI | InChI=1S/C23H30FNO/c1-25(2)22-17-20(16-19-8-10-21(24)11-9-19)13-15-23(22,26)14-12-18-6-4-3-5-7-18/h3-11,20,22,26H,12-17H2,1-2H3 |
| InChIKey | BIWVKOVLPRFMEM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |