C24H32ClNO — CID 23105878
4-[(4-chlorophenyl)methyl]-2-[(dimethylamino)methyl]-1-(2-phenylethyl)cyclohexan-1-ol (PubChem CID 23105878) has the molecular formula C24H32ClNO and a molecular weight of 385.98 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-[(dimethylamino)methyl]-1-(2-phenylethyl)cyclohexan-1-ol.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-[(dimethylamino)methyl]-1-(2-phenylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 23105878 |
| Molecular Formula | C24H32ClNO |
| Molecular Weight | 385.98 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-[(dimethylamino)methyl]-1-(2-phenylethyl)cyclohexan-1-ol |
| SMILES | CN(C)CC1CC(Cc2ccc(Cl)cc2)CCC1(O)CCc1ccccc1 |
| InChI | InChI=1S/C24H32ClNO/c1-26(2)18-22-17-21(16-20-8-10-23(25)11-9-20)13-15-24(22,27)14-12-19-6-4-3-5-7-19/h3-11,21-22,27H,12-18H2,1-2H3 |
| InChIKey | KRZYLAISPONAHC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |