C22H38ClNO2 — CID 142627369
4-benzyl-2-[(dimethylamino)methyl]-1-(3-methoxypentyl)cyclohexan-1-ol;hydrochloride (PubChem CID 142627369) has the molecular formula C22H38ClNO2 and a molecular weight of 384.00 g/mol. Its IUPAC name is 4-benzyl-2-[(dimethylamino)methyl]-1-(3-methoxypentyl)cyclohexan-1-ol;hydrochloride.
| Compound Name | 4-benzyl-2-[(dimethylamino)methyl]-1-(3-methoxypentyl)cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 142627369 |
| Molecular Formula | C22H38ClNO2 |
| Molecular Weight | 384.00 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 4-benzyl-2-[(dimethylamino)methyl]-1-(3-methoxypentyl)cyclohexan-1-ol;hydrochloride |
| SMILES | CCC(CCC1(O)CCC(Cc2ccccc2)CC1CN(C)C)OC.Cl |
| InChI | InChI=1S/C22H37NO2.ClH/c1-5-21(25-4)12-14-22(24)13-11-19(16-20(22)17-23(2)3)15-18-9-7-6-8-10-18;/h6-10,19-21,24H,5,11-17H2,1-4H3;1H |
| InChIKey | PSKNWMICGCWTDY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.00 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |