C21H22N2 — CID 141067500
2-methyl-N-[[2-(3-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]aniline (PubChem CID 141067500) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-methyl-N-[[2-(3-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]aniline.
| Compound Name | 2-methyl-N-[[2-(3-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]aniline |
|---|---|
| PubChem CID | 141067500 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 2-methyl-N-[[2-(3-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]aniline |
| SMILES | CC1=CC(CC(=NNc2ccccc2C)c2ccccc2)C=C1 |
| InChI | InChI=1S/C21H22N2/c1-16-12-13-18(14-16)15-21(19-9-4-3-5-10-19)23-22-20-11-7-6-8-17(20)2/h3-14,18,22H,15H2,1-2H3 |
| InChIKey | UBDVZEDZOVPXME-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|