C24H28N2 — CID 141067292
N-[[2-(2-tert-butylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]-2-methylaniline (PubChem CID 141067292) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[[2-(2-tert-butylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]-2-methylaniline.
| Compound Name | N-[[2-(2-tert-butylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]-2-methylaniline |
|---|---|
| PubChem CID | 141067292 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N-[[2-(2-tert-butylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]-2-methylaniline |
| SMILES | Cc1ccccc1NN=C(CC1C=CC=C1C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H28N2/c1-18-11-8-9-16-22(18)25-26-23(19-12-6-5-7-13-19)17-20-14-10-15-21(20)24(2,3)4/h5-16,20,25H,17H2,1-4H3 |
| InChIKey | JCFPABBHVKNLPX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|