C20H26N2 — CID 141066966
N-[[2-(3-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]cyclohexanamine (PubChem CID 141066966) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N-[[2-(3-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]cyclohexanamine.
| Compound Name | N-[[2-(3-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]cyclohexanamine |
|---|---|
| PubChem CID | 141066966 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-[[2-(3-methylcyclopenta-2,4-dien-1-yl)-1-phenylethylidene]amino]cyclohexanamine |
| SMILES | CC1=CC(CC(=NNC2CCCCC2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C20H26N2/c1-16-12-13-17(14-16)15-20(18-8-4-2-5-9-18)22-21-19-10-6-3-7-11-19/h2,4-5,8-9,12-14,17,19,21H,3,6-7,10-11,15H2,1H3 |
| InChIKey | GTDTXOCBRQVXCF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|