C28H32N2O3S2 — CID 141072262
N-benzyl-1-(1,3-diphenylpropan-2-ylsulfonyl)-N-methyl-4-sulfanylpyrrolidine-2-carboxamide (PubChem CID 141072262) has the molecular formula C28H32N2O3S2 and a molecular weight of 508.71 g/mol. Its IUPAC name is N-benzyl-1-(1,3-diphenylpropan-2-ylsulfonyl)-N-methyl-4-sulfanylpyrrolidine-2-carboxamide.
| Compound Name | N-benzyl-1-(1,3-diphenylpropan-2-ylsulfonyl)-N-methyl-4-sulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 141072262 |
| Molecular Formula | C28H32N2O3S2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-benzyl-1-(1,3-diphenylpropan-2-ylsulfonyl)-N-methyl-4-sulfanylpyrrolidine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CC(S)CN1S(=O)(=O)C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H32N2O3S2/c1-29(20-24-15-9-4-10-16-24)28(31)27-19-25(34)21-30(27)35(32,33)26(17-22-11-5-2-6-12-22)18-23-13-7-3-8-14-23/h2-16,25-27,34H,17-21H2,1H3 |
| InChIKey | PQNXZVQEFWCEOH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|