C19H21BrN2O4S — CID 141076615
2-[[4-(bromomethyl)phenyl]methyl]-5-[(2,4-dimethoxyphenyl)methyl]-1,2,5-thiadiazole 1,1-dioxide (PubChem CID 141076615) has the molecular formula C19H21BrN2O4S and a molecular weight of 453.36 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)phenyl]methyl]-5-[(2,4-dimethoxyphenyl)methyl]-1,2,5-thiadiazole 1,1-dioxide.
| Compound Name | 2-[[4-(bromomethyl)phenyl]methyl]-5-[(2,4-dimethoxyphenyl)methyl]-1,2,5-thiadiazole 1,1-dioxide |
|---|---|
| PubChem CID | 141076615 |
| Molecular Formula | C19H21BrN2O4S |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 2-[[4-(bromomethyl)phenyl]methyl]-5-[(2,4-dimethoxyphenyl)methyl]-1,2,5-thiadiazole 1,1-dioxide |
| SMILES | COc1ccc(CN2C=CN(Cc3ccc(CBr)cc3)S2(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C19H21BrN2O4S/c1-25-18-8-7-17(19(11-18)26-2)14-22-10-9-21(27(22,23)24)13-16-5-3-15(12-20)4-6-16/h3-11H,12-14H2,1-2H3 |
| InChIKey | XVAMAKJRAJZFDW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|