C17H19N3 — CID 14107793
2-[(5aS,6aR,9R)-7-methyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile (PubChem CID 14107793) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[(5aS,6aR,9R)-7-methyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile.
| Compound Name | 2-[(5aS,6aR,9R)-7-methyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile |
|---|---|
| PubChem CID | 14107793 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-[(5aS,6aR,9R)-7-methyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile |
| SMILES | CN1C[C@H](CC#N)C=C2c3cccc4c3[C@@H](CN4)C[C@H]21 |
| InChI | InChI=1S/C17H19N3/c1-20-10-11(5-6-18)7-14-13-3-2-4-15-17(13)12(9-19-15)8-16(14)20/h2-4,7,11-12,16,19H,5,8-10H2,1H3/t11-,12-,16-/m1/s1 |
| InChIKey | UBULIBNSZMFGMU-XHBSWPGZSA-N |
| XLogP | 2.83 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |