C22H24N2S — CID 14107796
(5aS,6aR,9R)-7-methyl-9-(phenylsulfanylmethyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 14107796) has the molecular formula C22H24N2S and a molecular weight of 348.51 g/mol. Its IUPAC name is (5aS,6aR,9R)-7-methyl-9-(phenylsulfanylmethyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (5aS,6aR,9R)-7-methyl-9-(phenylsulfanylmethyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 14107796 |
| Molecular Formula | C22H24N2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (5aS,6aR,9R)-7-methyl-9-(phenylsulfanylmethyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CN1C[C@H](CSc2ccccc2)C=C2c3cccc4c3[C@@H](CN4)C[C@H]21 |
| InChI | InChI=1S/C22H24N2S/c1-24-13-15(14-25-17-6-3-2-4-7-17)10-19-18-8-5-9-20-22(18)16(12-23-20)11-21(19)24/h2-10,15-16,21,23H,11-14H2,1H3/t15-,16-,21-/m1/s1 |
| InChIKey | OONDWRMFJIXGII-WHSLLNHNSA-N |
| XLogP | 4.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |