About S-octan-2-yl prop-2-enethioate
S-octan-2-yl prop-2-enethioate (PubChem CID 141082547) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is S-octan-2-yl prop-2-enethioate.
Molecular Properties
| Compound Name | S-octan-2-yl prop-2-enethioate |
| PubChem CID | 141082547 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | S-octan-2-yl prop-2-enethioate |
| SMILES | C=CC(=O)SC(C)CCCCCC |
| InChI | InChI=1S/C11H20OS/c1-4-6-7-8-9-10(3)13-11(12)5-2/h5,10H,2,4,6-9H2,1,3H3 |
| InChIKey | RAUSYQZXBTVEJZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-octan-2-yl prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-octan-2-yl prop-2-enethioate?
The IUPAC name of S-octan-2-yl prop-2-enethioate (CID 141082547) is S-octan-2-yl prop-2-enethioate.
What is the SMILES notation for S-octan-2-yl prop-2-enethioate?
The canonical SMILES for S-octan-2-yl prop-2-enethioate is C=CC(=O)SC(C)CCCCCC.
What is the InChIKey of S-octan-2-yl prop-2-enethioate?
The InChIKey is RAUSYQZXBTVEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OS/c1-4-6-7-8-9-10(3)13-11(12)5-2/h5,10H,2,4,6-9H2,1,3H3.
What are the key properties of S-octan-2-yl prop-2-enethioate?
S-octan-2-yl prop-2-enethioate has a molecular weight of 200.35 g/mol, XLogP of 3.79, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-octan-2-yl prop-2-enethioate is sourced from PubChem (CID 141082547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).