C16H33NO2Si — CID 141083233
1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl-dimethoxy-(3-methylbutyl)silane (PubChem CID 141083233) has the molecular formula C16H33NO2Si and a molecular weight of 299.53 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl-dimethoxy-(3-methylbutyl)silane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl-dimethoxy-(3-methylbutyl)silane |
|---|---|
| PubChem CID | 141083233 |
| Molecular Formula | C16H33NO2Si |
| Molecular Weight | 299.53 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-1-yl-dimethoxy-(3-methylbutyl)silane |
| SMILES | CO[Si](CCC(C)C)(OC)C1NCCC2CCCCC21 |
| InChI | InChI=1S/C16H33NO2Si/c1-13(2)10-12-20(18-3,19-4)16-15-8-6-5-7-14(15)9-11-17-16/h13-17H,5-12H2,1-4H3 |
| InChIKey | TWSMSYSDEJVGJD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|