C34H38N2O — CID 141087659
(4R,4aR,7R,7aR,12bS)-N,N-dibenzyl-3-(cyclopropylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-amine (PubChem CID 141087659) has the molecular formula C34H38N2O and a molecular weight of 490.69 g/mol. Its IUPAC name is (4R,4aR,7R,7aR,12bS)-N,N-dibenzyl-3-(cyclopropylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-amine.
| Compound Name | (4R,4aR,7R,7aR,12bS)-N,N-dibenzyl-3-(cyclopropylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-amine |
|---|---|
| PubChem CID | 141087659 |
| Molecular Formula | C34H38N2O |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | (4R,4aR,7R,7aR,12bS)-N,N-dibenzyl-3-(cyclopropylmethyl)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-amine |
| SMILES | c1ccc(CN(Cc2ccccc2)[C@@H]2CC[C@H]3[C@H]4Cc5cccc6c5[C@@]3(CCN4CC3CC3)[C@H]2O6)cc1 |
| InChI | InChI=1S/C34H38N2O/c1-3-8-24(9-4-1)22-36(23-25-10-5-2-6-11-25)29-17-16-28-30-20-27-12-7-13-31-32(27)34(28,33(29)37-31)18-19-35(30)21-26-14-15-26/h1-13,26,28-30,33H,14-23H2/t28-,29+,30+,33-,34-/m0/s1 |
| InChIKey | OWHCNPFEEVQLOI-PLZDBGLOSA-N |
| XLogP | 6.21 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |