C12H22N2O4 — CID 141093114
tert-butyl N-[(3S,4S)-3-hydroxy-4-prop-2-enoxypyrrolidin-3-yl]carbamate (PubChem CID 141093114) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-3-hydroxy-4-prop-2-enoxypyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-3-hydroxy-4-prop-2-enoxypyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 141093114 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | tert-butyl N-[(3S,4S)-3-hydroxy-4-prop-2-enoxypyrrolidin-3-yl]carbamate |
| SMILES | C=CCO[C@H]1CNC[C@@]1(O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O4/c1-5-6-17-9-7-13-8-12(9,16)14-10(15)18-11(2,3)4/h5,9,13,16H,1,6-8H2,2-4H3,(H,14,15)/t9-,12-/m0/s1 |
| InChIKey | DKAQZDHAGNILLS-CABZTGNLSA-N |
| XLogP | 0.37 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|