C17H12Cl2N2 — CID 141094187
4-(2,4-dichlorophenyl)-1-(2-phenylethenyl)imidazole (PubChem CID 141094187) has the molecular formula C17H12Cl2N2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-1-(2-phenylethenyl)imidazole.
| Compound Name | 4-(2,4-dichlorophenyl)-1-(2-phenylethenyl)imidazole |
|---|---|
| PubChem CID | 141094187 |
| Molecular Formula | C17H12Cl2N2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-1-(2-phenylethenyl)imidazole |
| SMILES | Clc1ccc(-c2cn(C=Cc3ccccc3)cn2)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N2/c18-14-6-7-15(16(19)10-14)17-11-21(12-20-17)9-8-13-4-2-1-3-5-13/h1-12H |
| InChIKey | VZSVPHDFJUWWDR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |