About (2-butyl-6-phenylphenyl) thiocyanate
(2-butyl-6-phenylphenyl) thiocyanate (PubChem CID 141095139) has the molecular formula C17H17NS
and a molecular weight of 267.40 g/mol. Its IUPAC name is (2-butyl-6-phenylphenyl) thiocyanate.
Molecular Properties
| Compound Name | (2-butyl-6-phenylphenyl) thiocyanate |
| PubChem CID | 141095139 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (2-butyl-6-phenylphenyl) thiocyanate |
| SMILES | CCCCc1cccc(-c2ccccc2)c1SC#N |
| InChI | InChI=1S/C17H17NS/c1-2-3-8-15-11-7-12-16(17(15)19-13-18)14-9-5-4-6-10-14/h4-7,9-12H,2-3,8H2,1H3 |
| InChIKey | XOVBRRLUCHTQBV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-butyl-6-phenylphenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butyl-6-phenylphenyl) thiocyanate?
The IUPAC name of (2-butyl-6-phenylphenyl) thiocyanate (CID 141095139) is (2-butyl-6-phenylphenyl) thiocyanate.
What is the SMILES notation for (2-butyl-6-phenylphenyl) thiocyanate?
The canonical SMILES for (2-butyl-6-phenylphenyl) thiocyanate is CCCCc1cccc(-c2ccccc2)c1SC#N.
What is the InChIKey of (2-butyl-6-phenylphenyl) thiocyanate?
The InChIKey is XOVBRRLUCHTQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NS/c1-2-3-8-15-11-7-12-16(17(15)19-13-18)14-9-5-4-6-10-14/h4-7,9-12H,2-3,8H2,1H3.
What are the key properties of (2-butyl-6-phenylphenyl) thiocyanate?
(2-butyl-6-phenylphenyl) thiocyanate has a molecular weight of 267.40 g/mol, XLogP of 5.27, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butyl-6-phenylphenyl) thiocyanate is sourced from PubChem (CID 141095139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).