C15H25F9O3S2 — CID 141102388
[dimethyl(nonyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 141102388) has the molecular formula C15H25F9O3S2 and a molecular weight of 488.48 g/mol. Its IUPAC name is [dimethyl(nonyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [dimethyl(nonyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141102388 |
| Molecular Formula | C15H25F9O3S2 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [dimethyl(nonyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCCCCCS(C)(C)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H25F9O3S2/c1-4-5-6-7-8-9-10-11-28(2,3)27-29(25,26)15(23,24)13(18,19)12(16,17)14(20,21)22/h4-11H2,1-3H3 |
| InChIKey | XPUKKFANUACTOU-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|