C15H19N3O — CID 141106942
N'-[2-(dimethylamino)ethyl]-2-phenylfuran-3-carboximidamide (PubChem CID 141106942) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-2-phenylfuran-3-carboximidamide.
| Compound Name | N'-[2-(dimethylamino)ethyl]-2-phenylfuran-3-carboximidamide |
|---|---|
| PubChem CID | 141106942 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-2-phenylfuran-3-carboximidamide |
| SMILES | CN(C)CC/N=C(\N)c1ccoc1-c1ccccc1 |
| InChI | InChI=1S/C15H19N3O/c1-18(2)10-9-17-15(16)13-8-11-19-14(13)12-6-4-3-5-7-12/h3-8,11H,9-10H2,1-2H3,(H2,16,17) |
| InChIKey | WYKIBFOFEGDKMQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|