About 1-methoxyethyl dimethyl borate
1-methoxyethyl dimethyl borate (PubChem CID 141109982) has the molecular formula C5H13BO4
and a molecular weight of 147.97 g/mol. Its IUPAC name is 1-methoxyethyl dimethyl borate.
Molecular Properties
| Compound Name | 1-methoxyethyl dimethyl borate |
| PubChem CID | 141109982 |
| Molecular Formula | C5H13BO4 |
| Molecular Weight | 147.97 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1-methoxyethyl dimethyl borate |
| SMILES | COB(OC)OC(C)OC |
| InChI | InChI=1S/C5H13BO4/c1-5(7-2)10-6(8-3)9-4/h5H,1-4H3 |
| InChIKey | LMGJYVQIAAXVRI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.97 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethyl dimethyl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethyl dimethyl borate?
The IUPAC name of 1-methoxyethyl dimethyl borate (CID 141109982) is 1-methoxyethyl dimethyl borate.
What is the SMILES notation for 1-methoxyethyl dimethyl borate?
The canonical SMILES for 1-methoxyethyl dimethyl borate is COB(OC)OC(C)OC.
What is the InChIKey of 1-methoxyethyl dimethyl borate?
The InChIKey is LMGJYVQIAAXVRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13BO4/c1-5(7-2)10-6(8-3)9-4/h5H,1-4H3.
What are the key properties of 1-methoxyethyl dimethyl borate?
1-methoxyethyl dimethyl borate has a molecular weight of 147.97 g/mol, XLogP of 0.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethyl dimethyl borate is sourced from PubChem (CID 141109982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).