C18H28N2O4 — CID 141112112
N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-2-(4-propoxybutyl)benzamide (PubChem CID 141112112) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-2-(4-propoxybutyl)benzamide.
| Compound Name | N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-2-(4-propoxybutyl)benzamide |
|---|---|
| PubChem CID | 141112112 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-2-(4-propoxybutyl)benzamide |
| SMILES | CCCOCCCCc1ccccc1C(=O)N[C@H](C(N)=O)[C@@H](C)O |
| InChI | InChI=1S/C18H28N2O4/c1-3-11-24-12-7-6-9-14-8-4-5-10-15(14)18(23)20-16(13(2)21)17(19)22/h4-5,8,10,13,16,21H,3,6-7,9,11-12H2,1-2H3,(H2,19,22)(H,20,23)/t13-,16+/m1/s1 |
| InChIKey | IQCNNEMEZAYXKR-CJNGLKHVSA-N |
| XLogP | 1.40 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|