C26H37N3O3 — CID 141116433
tert-butyl 2-[2-(1-hydroxycyclohexyl)-2-quinolin-3-ylethyl]piperazine-1-carboxylate (PubChem CID 141116433) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is tert-butyl 2-[2-(1-hydroxycyclohexyl)-2-quinolin-3-ylethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(1-hydroxycyclohexyl)-2-quinolin-3-ylethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141116433 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | tert-butyl 2-[2-(1-hydroxycyclohexyl)-2-quinolin-3-ylethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1CC(c1cnc2ccccc2c1)C1(O)CCCCC1 |
| InChI | InChI=1S/C26H37N3O3/c1-25(2,3)32-24(30)29-14-13-27-18-21(29)16-22(26(31)11-7-4-8-12-26)20-15-19-9-5-6-10-23(19)28-17-20/h5-6,9-10,15,17,21-22,27,31H,4,7-8,11-14,16,18H2,1-3H3 |
| InChIKey | HWBRJZCJCHTFAO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |