C10H11NO2 — CID 141122677
furan-2-yl(1,2,3,4-tetrahydropyridin-2-yl)methanone (PubChem CID 141122677) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is furan-2-yl(1,2,3,4-tetrahydropyridin-2-yl)methanone.
| Compound Name | furan-2-yl(1,2,3,4-tetrahydropyridin-2-yl)methanone |
|---|---|
| PubChem CID | 141122677 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | furan-2-yl(1,2,3,4-tetrahydropyridin-2-yl)methanone |
| SMILES | O=C(c1ccco1)C1CCC=CN1 |
| InChI | InChI=1S/C10H11NO2/c12-10(9-5-3-7-13-9)8-4-1-2-6-11-8/h2-3,5-8,11H,1,4H2 |
| InChIKey | VQAOZVDLAWARGX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |