C21H30ClN3O3 — CID 141128727
3-[2-chloro-5-(1,3-dihydroxy-1,3,4,5,6,7-hexahydroisoindol-2-yl)phenyl]-1,1-dipropylurea (PubChem CID 141128727) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is 3-[2-chloro-5-(1,3-dihydroxy-1,3,4,5,6,7-hexahydroisoindol-2-yl)phenyl]-1,1-dipropylurea.
| Compound Name | 3-[2-chloro-5-(1,3-dihydroxy-1,3,4,5,6,7-hexahydroisoindol-2-yl)phenyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 141128727 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 3-[2-chloro-5-(1,3-dihydroxy-1,3,4,5,6,7-hexahydroisoindol-2-yl)phenyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1cc(N2C(O)C3=C(CCCC3)C2O)ccc1Cl |
| InChI | InChI=1S/C21H30ClN3O3/c1-3-11-24(12-4-2)21(28)23-18-13-14(9-10-17(18)22)25-19(26)15-7-5-6-8-16(15)20(25)27/h9-10,13,19-20,26-27H,3-8,11-12H2,1-2H3,(H,23,28) |
| InChIKey | VVHGRDYERZMQQR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|